Have an account?
Skip to Content
Build your own quiz
Suggestions for you
Chemistry
10th -
12thgrade
Writing Chemical Equations, Balancing and Types of Reactions
20 questions
Show Answers
See Preview
- 1. Multiple ChoiceWhich is the correct formula for the compound formed between beryllium and nitrogen?BeNBe3NBe3N2Be2N3
- 2. Multiple ChoiceWhich is the correct formula for the compound Chromium (II) Nitrate?Cr2NO3(Cr)2NO3CrNO2Cr(NO3)2
- 3. Multiple ChoiceWhich is the correct name for the compound Na3P?Sodium PhosphideSodium PhosphiteSodium PhosphateSodium (III) Phosphide
- 4. Multiple ChoiceWhich is NOT a diatomic molecule?FluorineNitrogenBoronBromine
- 5. Multiple ChoiceWhich is the correct name for the compound N2O3?dinitro trioxidenitrogen (II) oxide (III)trinitrogen dioxidedinitrogen trioxide
- 6. Multiple ChoiceWhich is the correct name for the compound PCl5?monophosphorus tetrachloridephosphorus chloridephosphorus pentachloridepentaphosphorus chloride
- 7. Multiple ChoiceWhich is the correct name for the compound N2O4?tetranitrogen dioxidedinitrogen tetroxidedinitrogen quadoxidenitrogen oxide
- 8. Multiple ChoiceWhich type of chemical reaction is shown?double replacementcompositioncombustiondecomposition
- 9. Multiple ChoiceWhich type of reaction can be recognized by the general pattern?combustionsingle replacementcompositiondecomposition
- 10. Multiple ChoiceWhat is the correct ratio of coefficients to balance this chemical equation?1:2:31:2:1:52:4:31:1:2
- 11. Multiple ChoiceWhich type of reaction is Al + O2 → Al2O3?compositiondecompositionsingle replacementcombustion
- 12. Multiple ChoiceWhat is the molar mass of hydrogen peroxide (H2O2)?9 g/mol17 g/mol18 g/mol34 g/mol
- 13. Multiple ChoiceWhich compound contains both covalent and ionic bonds?CaCO3CO2H2ONaCl
- 14. Multiple Choice
What is the correct name for the acid whose chemical formula is H2SO4? Sulfuric acid
hydrosulfuric acidhydrosulfurous acidsulfurous acidsulfuric acid - 15. Multiple ChoiceWhat is the name of the compound with the chemical formula CrCl3?chromium tetrachloridechromium trichloridechromium (II) chloridechromium (III) chloride
- 16. Multiple ChoiceAluminum (Al) has three electrons in its outer shell. Oxygen (O) needs two electrons to complete its outer shell. What is the chemical formula for aluminum oxide?AlOAlO2Al2OAl2O3
- 17. Multiple ChoiceIdentify the type of chemical reaction demonstrated by this equation:
KClO3 → KCl + O2decompositioncombustioncompositionssingle replacement - 18. Multiple ChoiceWhich type of chemical reaction is this an example of?
Fe2(SO4)3 + KOH → K2SO4 + Fe(OH)3compositiondouble replacementsingle replacementcombustion - 19. Multiple ChoiceIdentify the type of reaction shown by this chemical equation:
Al + HCl → AlCl3 + H2single replacementcompositiondouble replacementdecomposition - 20. Multiple Choice
Which is the correctly balanced equaition?
Cl2 + 2NaI → 2NaCl + I2
Cl2 + 2NaI → NaCl + 2I2
Cl2 + NaI → NaCl + I2
2Cl2 + NaI → 2NaCl + I2
- Answer choicesTagsAnswer choicesTags