Have an account?
Skip to Content
Build your own quiz
Suggestions for you
15 questions
Show Answers
See Preview
- 1. Multiple Choice
-1sec θ- csc θ- sec θ - 2. Multiple ChoicePlease choose the correct sum and difference formula:
sin (α-β) =sin α cos β + cos α sin βsin α cos β - cos α sin βcos α cos β - sin α sin βcos α cos β + sin α sin β - 3. Multiple ChoiceWrite the following expression as the sine, cosine, or tangent of an angle.
cos(175)cos(55)+sin(175)sin(55)sin(120)cos(120)cos(230)sin(230) - 4. Multiple ChoiceFind the exact value of the expression.
cos(20)cos(40) - sin(20)sin(40)1/41/2√(3)/2√(3) - 5. Multiple ChoiceIf the point (-2, 5) is on the terminal side of an angle in standard position, find the cosine of that angle.-5/2-2/55√(29)/29-2√(29)/29
- 6. Multiple ChoiceFind the exact value of the expression.
sin(5π/12)cos(π/4) - cos(5π/12)sin(π/4)1/2-1/2-√(2)/2√(3)/2 - 7. Multiple ChoiceSolve for the misssing distance18.919.54727.5
- 8. Multiple ChoiceWhich scenario describes the picture shown?A 5 foot ramp is 8 feet away from a building. What is the angle that the ramp makes with the ground?A 5 foot ramp leans against an 8 foot structure. What is the angle that the ramp makes with the ground?An 8 foot ramp leans
against a building 5 feet away. What angle does the ramp make with the ground?A 5 foot man is 8 feet away from a building. What is the angle of elevation? - 9. Multiple ChoiceSolve for the missing angle.50.5 degrees12.7 degrees36.9 degrees72.2 degrees
- 10. Multiple ChoiceWhich is not a version of the double angle formula for cosines?cos2(x)-sin2(x)2cos2x-1cos2x+sin2x1-2sin2(x)
- 11. Multiple ChoiceSimpilfy the expression.√3√3 ∕ 21
1 ∕ 2√2 ∕ 2 - 12. Multiple ChoiceSimlify the expression assuming that 20x=π12-1-2
- 13. Multiple ChoiceWrite the following expression as the sine, cosine, or tangent of an angle.sec50⁰csc50⁰cos50⁰sin50⁰
- 14. Multiple ChoiceRewrite the expression above in terms of 'p' assuming that sin 63 = p2p√2p-√2p2√2p
- 15. Multiple ChoiceFind the exact value of the expression cos 80⁰+cos 20⁰+√3.cos130⁰ .02√3cos50sin40⁰2
- Answer choicesTagsAnswer choicesTags